C9H15Cl3O2Si — CID 175573579
3-(2,2,2-trichloroethylsilyl)propyl 2-methylprop-2-enoate (PubChem CID 175573579) has the molecular formula C9H15Cl3O2Si and a molecular weight of 289.66 g/mol. Its IUPAC name is 3-(2,2,2-trichloroethylsilyl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(2,2,2-trichloroethylsilyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175573579 |
| Molecular Formula | C9H15Cl3O2Si |
| Molecular Weight | 289.66 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 3-(2,2,2-trichloroethylsilyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH2]CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H15Cl3O2Si/c1-7(2)8(13)14-4-3-5-15-6-9(10,11)12/h1,3-6,15H2,2H3 |
| InChIKey | DOYBLBSJLSSFMW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|