C16H24F4O3Si — CID 154500746
di(propan-2-yloxy)methoxy-[3-(2,3,4,5-tetrafluorophenyl)propyl]silane (PubChem CID 154500746) has the molecular formula C16H24F4O3Si and a molecular weight of 368.44 g/mol. Its IUPAC name is di(propan-2-yloxy)methoxy-[3-(2,3,4,5-tetrafluorophenyl)propyl]silane.
| Compound Name | di(propan-2-yloxy)methoxy-[3-(2,3,4,5-tetrafluorophenyl)propyl]silane |
|---|---|
| PubChem CID | 154500746 |
| Molecular Formula | C16H24F4O3Si |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | di(propan-2-yloxy)methoxy-[3-(2,3,4,5-tetrafluorophenyl)propyl]silane |
| SMILES | CC(C)OC(O[SiH2]CCCc1cc(F)c(F)c(F)c1F)OC(C)C |
| InChI | InChI=1S/C16H24F4O3Si/c1-9(2)21-16(22-10(3)4)23-24-7-5-6-11-8-12(17)14(19)15(20)13(11)18/h8-10,16H,5-7,24H2,1-4H3 |
| InChIKey | AEJKOUPXQWYTEY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|