C12H13N3O2 — CID 154511465
4-acetyl-4-amino-5-phenyl-1,3-dihydropyrimidin-2-one (PubChem CID 154511465) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 4-acetyl-4-amino-5-phenyl-1,3-dihydropyrimidin-2-one.
| Compound Name | 4-acetyl-4-amino-5-phenyl-1,3-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 154511465 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-acetyl-4-amino-5-phenyl-1,3-dihydropyrimidin-2-one |
| SMILES | CC(=O)C1(N)NC(=O)NC=C1c1ccccc1 |
| InChI | InChI=1S/C12H13N3O2/c1-8(16)12(13)10(7-14-11(17)15-12)9-5-3-2-4-6-9/h2-7H,13H2,1H3,(H2,14,15,17) |
| InChIKey | UEBBTVMYBGACBZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |