C14H13N3O4 — CID 154511468
3-(4-amino-4-benzoyl-2-oxo-1,3-dihydropyrimidin-5-yl)prop-2-enoic acid (PubChem CID 154511468) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 3-(4-amino-4-benzoyl-2-oxo-1,3-dihydropyrimidin-5-yl)prop-2-enoic acid.
| Compound Name | 3-(4-amino-4-benzoyl-2-oxo-1,3-dihydropyrimidin-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 154511468 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-(4-amino-4-benzoyl-2-oxo-1,3-dihydropyrimidin-5-yl)prop-2-enoic acid |
| SMILES | NC1(C(=O)c2ccccc2)NC(=O)NC=C1C=CC(=O)O |
| InChI | InChI=1S/C14H13N3O4/c15-14(12(20)9-4-2-1-3-5-9)10(6-7-11(18)19)8-16-13(21)17-14/h1-8H,15H2,(H,18,19)(H2,16,17,21) |
| InChIKey | JDXNXUZRMUBTSC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|