C25H26F3N5O2 — CID 154513888
1-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]piperidin-4-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxamide (PubChem CID 154513888) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 1-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]piperidin-4-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxamide.
| Compound Name | 1-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]piperidin-4-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxamide |
|---|---|
| PubChem CID | 154513888 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]piperidin-4-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]c3c(c2c1)C(C1CCN(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1)NCC3 |
| InChI | InChI=1S/C25H26F3N5O2/c26-25(27,28)16-2-4-17(5-3-16)31-24(35)33-11-8-14(9-12-33)22-21-18-13-15(23(29)34)1-6-19(18)32-20(21)7-10-30-22/h1-6,13-14,22,30,32H,7-12H2,(H2,29,34)(H,31,35) |
| InChIKey | ZKAMGGLGKDIJQY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|