C19H19FNO5S+ — CID 154543935
CID 154543935 (PubChem CID 154543935) has the molecular formula C19H19FNO5S+ and a molecular weight of 392.43 g/mol.
| Compound Name | CID 154543935 |
|---|---|
| PubChem CID | 154543935 |
| Molecular Formula | C19H19FNO5S+ |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | — |
| SMILES | COC(=O)CCc1cn([S+](=O)(O)c2cccc(F)c2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C19H18FNO5S/c1-25-15-7-8-18-17(11-15)13(6-9-19(22)26-2)12-21(18)27(23,24)16-5-3-4-14(20)10-16/h3-5,7-8,10-12H,6,9H2,1-2H3/p+1 |
| InChIKey | YERVDUPPRCYKRQ-UHFFFAOYSA-O |
| XLogP | 3.69 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|