C8H14AlN3O — CID 154557056
2-alumanyl-8-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 154557056) has the molecular formula C8H14AlN3O and a molecular weight of 195.20 g/mol. Its IUPAC name is 2-alumanyl-8-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-alumanyl-8-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 154557056 |
| Molecular Formula | C8H14AlN3O |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-alumanyl-8-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CN1CCC2(CC1)N=C([AlH2])NC2=O |
| InChI | InChI=1S/C8H12N3O.Al.2H/c1-11-4-2-8(3-5-11)7(12)9-6-10-8;;;/h2-5H2,1H3,(H,9,10,12);;; |
| InChIKey | QFOUNLYVCKCTOQ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |