C23H32N2O3 — CID 154567367
(2,3-dimethyl-1H-indol-5-yl)-[(2R,4R)-4-hydroxy-2-propan-2-yl-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone (PubChem CID 154567367) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[(2R,4R)-4-hydroxy-2-propan-2-yl-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[(2R,4R)-4-hydroxy-2-propan-2-yl-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone |
|---|---|
| PubChem CID | 154567367 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[(2R,4R)-4-hydroxy-2-propan-2-yl-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCC4(CC3)C[C@H](O)C[C@H](C(C)C)O4)cc2c1C |
| InChI | InChI=1S/C23H32N2O3/c1-14(2)21-12-18(26)13-23(28-21)7-9-25(10-8-23)22(27)17-5-6-20-19(11-17)15(3)16(4)24-20/h5-6,11,14,18,21,24,26H,7-10,12-13H2,1-4H3/t18-,21-/m1/s1 |
| InChIKey | IGWKHBRBNVAHOY-WIYYLYMNSA-N |
| XLogP | 3.96 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|