C28H42N2O7Si — CID 154608144
[2-[4-[2-[2-[[(3R,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]ethoxy]ethoxy]phenyl]pyrimidin-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 154608144) has the molecular formula C28H42N2O7Si and a molecular weight of 546.74 g/mol. Its IUPAC name is [2-[4-[2-[2-[[(3R,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]ethoxy]ethoxy]phenyl]pyrimidin-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [2-[4-[2-[2-[[(3R,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]ethoxy]ethoxy]phenyl]pyrimidin-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 154608144 |
| Molecular Formula | C28H42N2O7Si |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [2-[4-[2-[2-[[(3R,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]ethoxy]ethoxy]phenyl]pyrimidin-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OCCOCCOc1ccc(-c2nccc(CO[Si](C)(C)C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C28H42N2O7Si/c1-28(2,3)38(5,6)37-17-21-11-12-29-27(30-21)20-7-9-22(10-8-20)33-15-13-32-14-16-34-24-19-36-25-23(31-4)18-35-26(24)25/h7-12,23-26H,13-19H2,1-6H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | MDPKSIWXRSCSFS-VEYUFSJPSA-N |
| XLogP | 4.26 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|