C13H16N2 — CID 154627943
3-(3,4-dihydropyridin-2-yl)-N,N-dimethylaniline (PubChem CID 154627943) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-(3,4-dihydropyridin-2-yl)-N,N-dimethylaniline.
| Compound Name | 3-(3,4-dihydropyridin-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 154627943 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-(3,4-dihydropyridin-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C2=NC=CCC2)c1 |
| InChI | InChI=1S/C13H16N2/c1-15(2)12-7-5-6-11(10-12)13-8-3-4-9-14-13/h4-7,9-10H,3,8H2,1-2H3 |
| InChIKey | MSCARSQTKXQHAB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |