C13H13ClFN5 — CID 154644092
7-chloro-4-(2,7-diazaspiro[3.4]octan-2-yl)-8-fluoropyrido[4,3-d]pyrimidine (PubChem CID 154644092) has the molecular formula C13H13ClFN5 and a molecular weight of 293.73 g/mol. Its IUPAC name is 7-chloro-4-(2,7-diazaspiro[3.4]octan-2-yl)-8-fluoropyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-4-(2,7-diazaspiro[3.4]octan-2-yl)-8-fluoropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 154644092 |
| Molecular Formula | C13H13ClFN5 |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 7-chloro-4-(2,7-diazaspiro[3.4]octan-2-yl)-8-fluoropyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(Cl)ncc2c(N3CC4(CCNC4)C3)ncnc12 |
| InChI | InChI=1S/C13H13ClFN5/c14-11-9(15)10-8(3-17-11)12(19-7-18-10)20-5-13(6-20)1-2-16-4-13/h3,7,16H,1-2,4-6H2 |
| InChIKey | BKVFXUAPZYSMHF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|