C8H16S2 — CID 154644686
ethane;2-prop-1-en-2-yl-1,3-dithiolane (PubChem CID 154644686) has the molecular formula C8H16S2 and a molecular weight of 176.35 g/mol. Its IUPAC name is ethane;2-prop-1-en-2-yl-1,3-dithiolane.
| Compound Name | ethane;2-prop-1-en-2-yl-1,3-dithiolane |
|---|---|
| PubChem CID | 154644686 |
| Molecular Formula | C8H16S2 |
| Molecular Weight | 176.35 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | ethane;2-prop-1-en-2-yl-1,3-dithiolane |
| SMILES | C=C(C)C1SCCS1.CC |
| InChI | InChI=1S/C6H10S2.C2H6/c1-5(2)6-7-3-4-8-6;1-2/h6H,1,3-4H2,2H3;1-2H3 |
| InChIKey | JCRDRDSQRPNNRC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|