C11H10FN3 — CID 154647177
2-(1-fluorocyclopropyl)-1,5-naphthyridin-4-amine (PubChem CID 154647177) has the molecular formula C11H10FN3 and a molecular weight of 203.22 g/mol. Its IUPAC name is 2-(1-fluorocyclopropyl)-1,5-naphthyridin-4-amine.
| Compound Name | 2-(1-fluorocyclopropyl)-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 154647177 |
| Molecular Formula | C11H10FN3 |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-(1-fluorocyclopropyl)-1,5-naphthyridin-4-amine |
| SMILES | Nc1cc(C2(F)CC2)nc2cccnc12 |
| InChI | InChI=1S/C11H10FN3/c12-11(3-4-11)9-6-7(13)10-8(15-9)2-1-5-14-10/h1-2,5-6H,3-4H2,(H2,13,15) |
| InChIKey | RRUYUVGCXQSHEZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |