C24H26BFN5O2S — CID 154667690
CID 154667690 (PubChem CID 154667690) has the molecular formula C24H26BFN5O2S and a molecular weight of 478.38 g/mol.
| Compound Name | CID 154667690 |
|---|---|
| PubChem CID | 154667690 |
| Molecular Formula | C24H26BFN5O2S |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | — |
| SMILES | C[B]n1ccc(C(=O)NCC(Nc2nc(-c3cc(F)c4c(c3)N(C)CCO4)cs2)=C2CCC2)c1 |
| InChI | InChI=1S/C24H26BFN5O2S/c1-25-31-7-6-16(13-31)23(32)27-12-19(15-4-3-5-15)28-24-29-20(14-34-24)17-10-18(26)22-21(11-17)30(2)8-9-33-22/h6-7,10-11,13-14H,3-5,8-9,12H2,1-2H3,(H,27,32)(H,28,29) |
| InChIKey | CZTIZBVHVHQFRU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|