C11H20N2O4 — CID 154682430
(2S,3S)-3-methyl-2-[methyl-[3-(methylamino)-3-oxopropanoyl]amino]pentanoic acid (PubChem CID 154682430) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[methyl-[3-(methylamino)-3-oxopropanoyl]amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[methyl-[3-(methylamino)-3-oxopropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 154682430 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (2S,3S)-3-methyl-2-[methyl-[3-(methylamino)-3-oxopropanoyl]amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)N(C)C(=O)CC(=O)NC |
| InChI | InChI=1S/C11H20N2O4/c1-5-7(2)10(11(16)17)13(4)9(15)6-8(14)12-3/h7,10H,5-6H2,1-4H3,(H,12,14)(H,16,17)/t7-,10-/m0/s1 |
| InChIKey | SCYPPAHWEAOARK-XVKPBYJWSA-N |
| XLogP | 0.08 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|