C18H29N9O4 — CID 154700551
2-[(4S)-4-amino-5-oxopentyl]-1-[3-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]propyl]guanidine (PubChem CID 154700551) has the molecular formula C18H29N9O4 and a molecular weight of 435.49 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5-oxopentyl]-1-[3-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]propyl]guanidine.
| Compound Name | 2-[(4S)-4-amino-5-oxopentyl]-1-[3-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 154700551 |
| Molecular Formula | C18H29N9O4 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-[(4S)-4-amino-5-oxopentyl]-1-[3-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]propyl]guanidine |
| SMILES | N/C(=N\CCC[C@H](N)C=O)NCCC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H29N9O4/c19-10(7-28)3-1-5-22-18(21)23-6-2-4-11-13(29)14(30)17(31-11)27-9-26-12-15(20)24-8-25-16(12)27/h7-11,13-14,17,29-30H,1-6,19H2,(H2,20,24,25)(H3,21,22,23)/t10-,11+,13+,14+,17+/m0/s1 |
| InChIKey | GNHXIUDEUOSIEM-YRGUDCOPSA-N |
| XLogP | -1.98 |
| TPSA | 212.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|