C14H16N4OS — CID 154700692
7-methylsulfanyl-11-propan-2-yl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 154700692) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 7-methylsulfanyl-11-propan-2-yl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 7-methylsulfanyl-11-propan-2-yl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 154700692 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 7-methylsulfanyl-11-propan-2-yl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | CSc1c(C#N)c2c(c3nncn13)COC(C(C)C)C2 |
| InChI | InChI=1S/C14H16N4OS/c1-8(2)12-4-9-10(5-15)14(20-3)18-7-16-17-13(18)11(9)6-19-12/h7-8,12H,4,6H2,1-3H3 |
| InChIKey | LFTLEGAJSFXZGY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |