C16H18N4OS — CID 154700735
11-propan-2-yl-7-prop-2-enylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 154700735) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 11-propan-2-yl-7-prop-2-enylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 11-propan-2-yl-7-prop-2-enylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 154700735 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 11-propan-2-yl-7-prop-2-enylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | C=CCSc1c(C#N)c2c(c3nncn13)COC(C(C)C)C2 |
| InChI | InChI=1S/C16H18N4OS/c1-4-5-22-16-12(7-17)11-6-14(10(2)3)21-8-13(11)15-19-18-9-20(15)16/h4,9-10,14H,1,5-6,8H2,2-3H3 |
| InChIKey | BXLLAILIXLBALD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|