C15H16N4OS — CID 154700708
11,11-dimethyl-7-prop-2-enylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 154700708) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 11,11-dimethyl-7-prop-2-enylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 11,11-dimethyl-7-prop-2-enylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 154700708 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 11,11-dimethyl-7-prop-2-enylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | C=CCSc1c(C#N)c2c(c3nncn13)COC(C)(C)C2 |
| InChI | InChI=1S/C15H16N4OS/c1-4-5-21-14-11(7-16)10-6-15(2,3)20-8-12(10)13-18-17-9-19(13)14/h4,9H,1,5-6,8H2,2-3H3 |
| InChIKey | HJLJNQZRUQROTH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|