C15H14N4OS — CID 154700707
11,11-dimethyl-7-prop-2-ynylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 154700707) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 11,11-dimethyl-7-prop-2-ynylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 11,11-dimethyl-7-prop-2-ynylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 154700707 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 11,11-dimethyl-7-prop-2-ynylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | C#CCSc1c(C#N)c2c(c3nncn13)COC(C)(C)C2 |
| InChI | InChI=1S/C15H14N4OS/c1-4-5-21-14-11(7-16)10-6-15(2,3)20-8-12(10)13-18-17-9-19(13)14/h1,9H,5-6,8H2,2-3H3 |
| InChIKey | FQRUQUUKJAETBG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|