C14H16N4OS2 — CID 154700714
11,11-dimethyl-5,7-bis(methylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 154700714) has the molecular formula C14H16N4OS2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 11,11-dimethyl-5,7-bis(methylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 11,11-dimethyl-5,7-bis(methylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 154700714 |
| Molecular Formula | C14H16N4OS2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 11,11-dimethyl-5,7-bis(methylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | CSc1nnc2c3c(c(C#N)c(SC)n12)CC(C)(C)OC3 |
| InChI | InChI=1S/C14H16N4OS2/c1-14(2)5-8-9(6-15)12(20-3)18-11(10(8)7-19-14)16-17-13(18)21-4/h5,7H2,1-4H3 |
| InChIKey | FMABSMGEAWRGMC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |