C21H22N4OS — CID 154700833
11,11-dimethyl-7-(3-phenylpropylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 154700833) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 11,11-dimethyl-7-(3-phenylpropylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 11,11-dimethyl-7-(3-phenylpropylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 154700833 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 11,11-dimethyl-7-(3-phenylpropylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | CC1(C)Cc2c(C#N)c(SCCCc3ccccc3)n3cnnc3c2CO1 |
| InChI | InChI=1S/C21H22N4OS/c1-21(2)11-16-17(12-22)20(25-14-23-24-19(25)18(16)13-26-21)27-10-6-9-15-7-4-3-5-8-15/h3-5,7-8,14H,6,9-11,13H2,1-2H3 |
| InChIKey | OYKZMFMCITZJKX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|