C20H17OP — CID 154700754
3,4-diphenyl-1,4-dihydro-2,3-benzoxaphosphinine (PubChem CID 154700754) has the molecular formula C20H17OP and a molecular weight of 304.33 g/mol. Its IUPAC name is 3,4-diphenyl-1,4-dihydro-2,3-benzoxaphosphinine.
| Compound Name | 3,4-diphenyl-1,4-dihydro-2,3-benzoxaphosphinine |
|---|---|
| PubChem CID | 154700754 |
| Molecular Formula | C20H17OP |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3,4-diphenyl-1,4-dihydro-2,3-benzoxaphosphinine |
| SMILES | c1ccc(C2c3ccccc3COP2c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17OP/c1-3-9-16(10-4-1)20-19-14-8-7-11-17(19)15-21-22(20)18-12-5-2-6-13-18/h1-14,20H,15H2 |
| InChIKey | KWZXZMWWCOWONW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|