C14H14N4O3S2 — CID 154704151
12-thiophen-3-ylsulfonyl-1,6,9,12-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6-trien-2-one (PubChem CID 154704151) has the molecular formula C14H14N4O3S2 and a molecular weight of 350.43 g/mol. Its IUPAC name is 12-thiophen-3-ylsulfonyl-1,6,9,12-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6-trien-2-one.
| Compound Name | 12-thiophen-3-ylsulfonyl-1,6,9,12-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 154704151 |
| Molecular Formula | C14H14N4O3S2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 12-thiophen-3-ylsulfonyl-1,6,9,12-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6-trien-2-one |
| SMILES | O=C1c2ccncc2NC2CN(S(=O)(=O)c3ccsc3)CCN12 |
| InChI | InChI=1S/C14H14N4O3S2/c19-14-11-1-3-15-7-12(11)16-13-8-17(4-5-18(13)14)23(20,21)10-2-6-22-9-10/h1-3,6-7,9,13,16H,4-5,8H2 |
| InChIKey | FZDTXXMBDAUXRY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |