C21H23NO — CID 154711008
N-[2-(1-cyclohexylethenyl)phenyl]benzamide (PubChem CID 154711008) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[2-(1-cyclohexylethenyl)phenyl]benzamide.
| Compound Name | N-[2-(1-cyclohexylethenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 154711008 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-[2-(1-cyclohexylethenyl)phenyl]benzamide |
| SMILES | C=C(c1ccccc1NC(=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H23NO/c1-16(17-10-4-2-5-11-17)19-14-8-9-15-20(19)22-21(23)18-12-6-3-7-13-18/h3,6-9,12-15,17H,1-2,4-5,10-11H2,(H,22,23) |
| InChIKey | PUMHFRJWQOBELV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |