C14H20Cl2N2O3S — CID 154739763
3,4-dichloro-N-[3-(4-hydroxypiperidin-1-yl)propyl]benzenesulfonamide (PubChem CID 154739763) has the molecular formula C14H20Cl2N2O3S and a molecular weight of 367.30 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-(4-hydroxypiperidin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[3-(4-hydroxypiperidin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 154739763 |
| Molecular Formula | C14H20Cl2N2O3S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 3,4-dichloro-N-[3-(4-hydroxypiperidin-1-yl)propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCN1CCC(O)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O3S/c15-13-3-2-12(10-14(13)16)22(20,21)17-6-1-7-18-8-4-11(19)5-9-18/h2-3,10-11,17,19H,1,4-9H2 |
| InChIKey | IVJXWWLIQNIUPO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|