C5H11N3S — CID 15475917
4-ethyl-1-methyl-1,2,4-triazolidine-3-thione (PubChem CID 15475917) has the molecular formula C5H11N3S and a molecular weight of 145.23 g/mol. Its IUPAC name is 4-ethyl-1-methyl-1,2,4-triazolidine-3-thione.
| Compound Name | 4-ethyl-1-methyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 15475917 |
| Molecular Formula | C5H11N3S |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 4-ethyl-1-methyl-1,2,4-triazolidine-3-thione |
| SMILES | CCN1CN(C)NC1=S |
| InChI | InChI=1S/C5H11N3S/c1-3-8-4-7(2)6-5(8)9/h3-4H2,1-2H3,(H,6,9) |
| InChIKey | XNZCHSISUFGHGI-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|