C6H13N3S — CID 4997175
2,4,5,5-tetramethyl-1,2,4-triazolidine-3-thione (PubChem CID 4997175) has the molecular formula C6H13N3S and a molecular weight of 159.26 g/mol. Its IUPAC name is 2,4,5,5-tetramethyl-1,2,4-triazolidine-3-thione.
| Compound Name | 2,4,5,5-tetramethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 4997175 |
| Molecular Formula | C6H13N3S |
| Molecular Weight | 159.26 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 2,4,5,5-tetramethyl-1,2,4-triazolidine-3-thione |
| SMILES | CN1NC(C)(C)N(C)C1=S |
| InChI | InChI=1S/C6H13N3S/c1-6(2)7-9(4)5(10)8(6)3/h7H,1-4H3 |
| InChIKey | DBKIGYJIJSFQDX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|