C5H12N3S- — CID 23394808
4-ethyl-1-methyl-1,2,4-triazolidine-3-thiolate (PubChem CID 23394808) has the molecular formula C5H12N3S- and a molecular weight of 146.24 g/mol. Its IUPAC name is 4-ethyl-1-methyl-1,2,4-triazolidine-3-thiolate.
| Compound Name | 4-ethyl-1-methyl-1,2,4-triazolidine-3-thiolate |
|---|---|
| PubChem CID | 23394808 |
| Molecular Formula | C5H12N3S- |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 4-ethyl-1-methyl-1,2,4-triazolidine-3-thiolate |
| SMILES | CCN1CN(C)NC1[S-] |
| InChI | InChI=1S/C5H13N3S/c1-3-8-4-7(2)6-5(8)9/h5-6,9H,3-4H2,1-2H3/p-1 |
| InChIKey | GSUXLFDRDYPBHW-UHFFFAOYSA-M |
| XLogP | -0.45 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|