C5H13N3S — CID 18341686
1,4,5-trimethyl-1,2,4-triazolidine-3-thiol (PubChem CID 18341686) has the molecular formula C5H13N3S and a molecular weight of 147.25 g/mol. Its IUPAC name is 1,4,5-trimethyl-1,2,4-triazolidine-3-thiol.
| Compound Name | 1,4,5-trimethyl-1,2,4-triazolidine-3-thiol |
|---|---|
| PubChem CID | 18341686 |
| Molecular Formula | C5H13N3S |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1,4,5-trimethyl-1,2,4-triazolidine-3-thiol |
| SMILES | CC1N(C)NC(S)N1C |
| InChI | InChI=1S/C5H13N3S/c1-4-7(2)5(9)6-8(4)3/h4-6,9H,1-3H3 |
| InChIKey | NKCUSFFPYGNZIH-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|