C6H14N3S- — CID 23394807
4-ethyl-1,5-dimethyl-1,2,4-triazolidine-3-thiolate (PubChem CID 23394807) has the molecular formula C6H14N3S- and a molecular weight of 160.27 g/mol. Its IUPAC name is 4-ethyl-1,5-dimethyl-1,2,4-triazolidine-3-thiolate.
| Compound Name | 4-ethyl-1,5-dimethyl-1,2,4-triazolidine-3-thiolate |
|---|---|
| PubChem CID | 23394807 |
| Molecular Formula | C6H14N3S- |
| Molecular Weight | 160.27 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 4-ethyl-1,5-dimethyl-1,2,4-triazolidine-3-thiolate |
| SMILES | CCN1C([S-])NN(C)C1C |
| InChI | InChI=1S/C6H15N3S/c1-4-9-5(2)8(3)7-6(9)10/h5-7,10H,4H2,1-3H3/p-1 |
| InChIKey | KNPBWRZZLSABJP-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|