C15H26N2O4 — CID 154824824
2-methoxyethyl 4-cyano-4-methyl-7-oxo-7-(propan-2-ylamino)heptanoate (PubChem CID 154824824) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-methoxyethyl 4-cyano-4-methyl-7-oxo-7-(propan-2-ylamino)heptanoate.
| Compound Name | 2-methoxyethyl 4-cyano-4-methyl-7-oxo-7-(propan-2-ylamino)heptanoate |
|---|---|
| PubChem CID | 154824824 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-methoxyethyl 4-cyano-4-methyl-7-oxo-7-(propan-2-ylamino)heptanoate |
| SMILES | COCCOC(=O)CCC(C)(C#N)CCC(=O)NC(C)C |
| InChI | InChI=1S/C15H26N2O4/c1-12(2)17-13(18)5-7-15(3,11-16)8-6-14(19)21-10-9-20-4/h12H,5-10H2,1-4H3,(H,17,18) |
| InChIKey | SWGYSMYICQRZDO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|