C28H29ClFN3O2 — CID 154856949
N-(4-tert-butylphenyl)-N-[1-(5-chloro-3-pyridinyl)-2-[2-(3-fluorophenyl)ethylamino]-2-oxoethyl]prop-2-enamide (PubChem CID 154856949) has the molecular formula C28H29ClFN3O2 and a molecular weight of 494.01 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-[1-(5-chloro-3-pyridinyl)-2-[2-(3-fluorophenyl)ethylamino]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-(4-tert-butylphenyl)-N-[1-(5-chloro-3-pyridinyl)-2-[2-(3-fluorophenyl)ethylamino]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 154856949 |
| Molecular Formula | C28H29ClFN3O2 |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-[1-(5-chloro-3-pyridinyl)-2-[2-(3-fluorophenyl)ethylamino]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(C(C)(C)C)cc1)C(C(=O)NCCc1cccc(F)c1)c1cncc(Cl)c1 |
| InChI | InChI=1S/C28H29ClFN3O2/c1-5-25(34)33(24-11-9-21(10-12-24)28(2,3)4)26(20-16-22(29)18-31-17-20)27(35)32-14-13-19-7-6-8-23(30)15-19/h5-12,15-18,26H,1,13-14H2,2-4H3,(H,32,35) |
| InChIKey | KCFLXQWWKKQMLY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|