C21H16F3N3OS — CID 154862461
1-(3-phenylprop-2-ynyl)-3-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methyl]urea (PubChem CID 154862461) has the molecular formula C21H16F3N3OS and a molecular weight of 415.44 g/mol. Its IUPAC name is 1-(3-phenylprop-2-ynyl)-3-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methyl]urea.
| Compound Name | 1-(3-phenylprop-2-ynyl)-3-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 154862461 |
| Molecular Formula | C21H16F3N3OS |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(3-phenylprop-2-ynyl)-3-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methyl]urea |
| SMILES | O=C(NCC#Cc1ccccc1)NCc1cnc(-c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C21H16F3N3OS/c22-21(23,24)17-10-8-16(9-11-17)19-26-13-18(29-19)14-27-20(28)25-12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11,13H,12,14H2,(H2,25,27,28) |
| InChIKey | SYYVJRXATXAUEI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|