C14H20N4O3 — CID 154869729
N-(2,5-dioxopyrrolidin-3-yl)-5-methyl-1-(3-methylbutyl)pyrazole-4-carboxamide (PubChem CID 154869729) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(2,5-dioxopyrrolidin-3-yl)-5-methyl-1-(3-methylbutyl)pyrazole-4-carboxamide.
| Compound Name | N-(2,5-dioxopyrrolidin-3-yl)-5-methyl-1-(3-methylbutyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 154869729 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-(2,5-dioxopyrrolidin-3-yl)-5-methyl-1-(3-methylbutyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC(=O)NC2=O)cnn1CCC(C)C |
| InChI | InChI=1S/C14H20N4O3/c1-8(2)4-5-18-9(3)10(7-15-18)13(20)16-11-6-12(19)17-14(11)21/h7-8,11H,4-6H2,1-3H3,(H,16,20)(H,17,19,21) |
| InChIKey | JURPFZHRNQOYOE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|