C23H21ClN2O2 — CID 154875779
N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-2-naphthalen-1-ylacetamide (PubChem CID 154875779) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 154875779 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(CCl)N[C@@H]1c2ccccc2C[C@H]1NC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C23H21ClN2O2/c24-14-22(28)26-23-19-11-4-2-7-16(19)12-20(23)25-21(27)13-17-9-5-8-15-6-1-3-10-18(15)17/h1-11,20,23H,12-14H2,(H,25,27)(H,26,28)/t20-,23-/m1/s1 |
| InChIKey | HCPLOEJJKITFTH-NFBKMPQASA-N |
| XLogP | 3.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|