C10H18ClN3O3S — CID 154922263
1-(2,5-dihydro-1H-pyrrole-2-carbonyl)piperidine-4-sulfonamide;hydrochloride (PubChem CID 154922263) has the molecular formula C10H18ClN3O3S and a molecular weight of 295.79 g/mol. Its IUPAC name is 1-(2,5-dihydro-1H-pyrrole-2-carbonyl)piperidine-4-sulfonamide;hydrochloride.
| Compound Name | 1-(2,5-dihydro-1H-pyrrole-2-carbonyl)piperidine-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 154922263 |
| Molecular Formula | C10H18ClN3O3S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-(2,5-dihydro-1H-pyrrole-2-carbonyl)piperidine-4-sulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)C1CCN(C(=O)C2C=CCN2)CC1 |
| InChI | InChI=1S/C10H17N3O3S.ClH/c11-17(15,16)8-3-6-13(7-4-8)10(14)9-2-1-5-12-9;/h1-2,8-9,12H,3-7H2,(H2,11,15,16);1H |
| InChIKey | JZYGPSKWLPLYAI-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|