C30H26ClNO4S — CID 154933870
2-[2-chloro-6-[[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]methyl]-4-methoxyphenyl]sulfanylbenzaldehyde (PubChem CID 154933870) has the molecular formula C30H26ClNO4S and a molecular weight of 532.06 g/mol. Its IUPAC name is 2-[2-chloro-6-[[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]methyl]-4-methoxyphenyl]sulfanylbenzaldehyde.
| Compound Name | 2-[2-chloro-6-[[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]methyl]-4-methoxyphenyl]sulfanylbenzaldehyde |
|---|---|
| PubChem CID | 154933870 |
| Molecular Formula | C30H26ClNO4S |
| Molecular Weight | 532.06 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 2-[2-chloro-6-[[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]methyl]-4-methoxyphenyl]sulfanylbenzaldehyde |
| SMILES | COc1cc(Cl)c(Sc2ccccc2C=O)c(CNC(O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C30H26ClNO4S/c1-35-21-14-20(29(27(31)15-21)37-28-13-7-2-8-19(28)17-33)16-32-30(34)36-18-26-24-11-5-3-9-22(24)23-10-4-6-12-25(23)26/h2-15,17,26,30,32,34H,16,18H2,1H3 |
| InChIKey | WRAJKNZAGMFWSV-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.06 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|