C30H34N6O5 — CID 154941800
ethyl 4-[2-[(2-ethyl-5-methylpyrazol-3-yl)amino]-1-[3-(phenylmethoxycarbonylamino)propyl]benzimidazol-4-yl]-4-hydroxybut-2-ynoate (PubChem CID 154941800) has the molecular formula C30H34N6O5 and a molecular weight of 558.64 g/mol. Its IUPAC name is ethyl 4-[2-[(2-ethyl-5-methylpyrazol-3-yl)amino]-1-[3-(phenylmethoxycarbonylamino)propyl]benzimidazol-4-yl]-4-hydroxybut-2-ynoate.
| Compound Name | ethyl 4-[2-[(2-ethyl-5-methylpyrazol-3-yl)amino]-1-[3-(phenylmethoxycarbonylamino)propyl]benzimidazol-4-yl]-4-hydroxybut-2-ynoate |
|---|---|
| PubChem CID | 154941800 |
| Molecular Formula | C30H34N6O5 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | ethyl 4-[2-[(2-ethyl-5-methylpyrazol-3-yl)amino]-1-[3-(phenylmethoxycarbonylamino)propyl]benzimidazol-4-yl]-4-hydroxybut-2-ynoate |
| SMILES | CCOC(=O)C#CC(O)c1cccc2c1nc(Nc1cc(C)nn1CC)n2CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H34N6O5/c1-4-36-26(19-21(3)34-36)32-29-33-28-23(25(37)15-16-27(38)40-5-2)13-9-14-24(28)35(29)18-10-17-31-30(39)41-20-22-11-7-6-8-12-22/h6-9,11-14,19,25,37H,4-5,10,17-18,20H2,1-3H3,(H,31,39)(H,32,33) |
| InChIKey | WPUXTSGRFWPHGL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|