C23H26N2O — CID 154968389
(E,4R)-2-[(3R)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine-1-carbonyl]-4-phenylpent-2-enenitrile (PubChem CID 154968389) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is (E,4R)-2-[(3R)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine-1-carbonyl]-4-phenylpent-2-enenitrile.
| Compound Name | (E,4R)-2-[(3R)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine-1-carbonyl]-4-phenylpent-2-enenitrile |
|---|---|
| PubChem CID | 154968389 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (E,4R)-2-[(3R)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolidine-1-carbonyl]-4-phenylpent-2-enenitrile |
| SMILES | C=C(/C=C\C=C/C)[C@H]1CCN(C(=O)/C(C#N)=C/[C@@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C23H26N2O/c1-4-5-7-10-18(2)21-13-14-25(17-21)23(26)22(16-24)15-19(3)20-11-8-6-9-12-20/h4-12,15,19,21H,2,13-14,17H2,1,3H3/b5-4-,10-7-,22-15+/t19-,21+/m1/s1 |
| InChIKey | SOKHZPIUXHPPIR-KOQGCSIKSA-N |
| XLogP | 4.78 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|