C26H47N6O15P3 — CID 154971231
[[5-[6-[6-(cyclooctylamino)hexylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(methylperoxy)phosphoryl] methoxy phosphate (PubChem CID 154971231) has the molecular formula C26H47N6O15P3 and a molecular weight of 776.61 g/mol. Its IUPAC name is [[5-[6-[6-(cyclooctylamino)hexylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(methylperoxy)phosphoryl] methoxy phosphate.
| Compound Name | [[5-[6-[6-(cyclooctylamino)hexylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(methylperoxy)phosphoryl] methoxy phosphate |
|---|---|
| PubChem CID | 154971231 |
| Molecular Formula | C26H47N6O15P3 |
| Molecular Weight | 776.61 g/mol |
| Exact Mass | 776.23 |
| IUPAC Name | [[5-[6-[6-(cyclooctylamino)hexylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy(methylperoxy)phosphoryl] methoxy phosphate |
| SMILES | COOP(=O)(O)OP(=O)(OOC)OP(=O)(O)OCC1OC(n2cnc3c(NCCCCCCNC4CCCCCCC4)ncnc32)C(O)C1O |
| InChI | InChI=1S/C26H47N6O15P3/c1-40-44-49(37,38)47-50(39,45-41-2)46-48(35,36)42-16-20-22(33)23(34)26(43-20)32-18-31-21-24(29-17-30-25(21)32)28-15-11-7-6-10-14-27-19-12-8-4-3-5-9-13-19/h17-20,22-23,26-27,33-34H,3-16H2,1-2H3,(H,35,36)(H,37,38)(H,28,29,30) |
| InChIKey | LOBKFKQMSLNTHR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 273.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|