C23H22ClF3N2O4S — CID 155004927
(2R,4S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-4-fluoro-N-(3-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 155004927) has the molecular formula C23H22ClF3N2O4S and a molecular weight of 514.95 g/mol. Its IUPAC name is (2R,4S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-4-fluoro-N-(3-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-4-fluoro-N-(3-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155004927 |
| Molecular Formula | C23H22ClF3N2O4S |
| Molecular Weight | 514.95 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | (2R,4S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-4-fluoro-N-(3-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)N(C(=O)[C@H]2C[C@H](F)CN2)[C@@H](c2cc(F)c(Cl)cc2F)C2CC2)c1 |
| InChI | InChI=1S/C23H22ClF3N2O4S/c1-34(32,33)15-4-2-3-13(7-15)22(30)29(23(31)20-8-14(25)11-28-20)21(12-5-6-12)16-9-19(27)17(24)10-18(16)26/h2-4,7,9-10,12,14,20-21,28H,5-6,8,11H2,1H3/t14-,20+,21+/m0/s1 |
| InChIKey | HCNKMUFQQLFGDH-LVXYXVKQSA-N |
| XLogP | 3.84 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|