C17H29F7 — CID 155017476
2,2,4,5,5,6-hexafluoro-6-(fluoromethyl)-7,7-dimethyl-4-(2-methylbutan-2-yl)nonane (PubChem CID 155017476) has the molecular formula C17H29F7 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2,2,4,5,5,6-hexafluoro-6-(fluoromethyl)-7,7-dimethyl-4-(2-methylbutan-2-yl)nonane.
| Compound Name | 2,2,4,5,5,6-hexafluoro-6-(fluoromethyl)-7,7-dimethyl-4-(2-methylbutan-2-yl)nonane |
|---|---|
| PubChem CID | 155017476 |
| Molecular Formula | C17H29F7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2,2,4,5,5,6-hexafluoro-6-(fluoromethyl)-7,7-dimethyl-4-(2-methylbutan-2-yl)nonane |
| SMILES | CCC(C)(C)C(F)(CF)C(F)(F)C(F)(CC(C)(F)F)C(C)(C)CC |
| InChI | InChI=1S/C17H29F7/c1-8-12(3,4)15(21,10-14(7,19)20)17(23,24)16(22,11-18)13(5,6)9-2/h8-11H2,1-7H3 |
| InChIKey | FAUYNCUYZWSJSH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |