C7H10N4 — CID 155049478
(1Z)-N-methyl-1-(1H-1,2,4-triazol-5-yl)buta-1,3-dien-1-amine (PubChem CID 155049478) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is (1Z)-N-methyl-1-(1H-1,2,4-triazol-5-yl)buta-1,3-dien-1-amine.
| Compound Name | (1Z)-N-methyl-1-(1H-1,2,4-triazol-5-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 155049478 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | (1Z)-N-methyl-1-(1H-1,2,4-triazol-5-yl)buta-1,3-dien-1-amine |
| SMILES | C=C/C=C(\NC)c1ncn[nH]1 |
| InChI | InChI=1S/C7H10N4/c1-3-4-6(8-2)7-9-5-10-11-7/h3-5,8H,1H2,2H3,(H,9,10,11)/b6-4- |
| InChIKey | MUCMBBIQJTUUMH-XQRVVYSFSA-N |
| XLogP | 0.55 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|