C10H18N2O6 — CID 155072145
(Z)-2-(dimethylamino)but-2-enamide;2-hydroxybutanedioic acid (PubChem CID 155072145) has the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. Its IUPAC name is (Z)-2-(dimethylamino)but-2-enamide;2-hydroxybutanedioic acid.
| Compound Name | (Z)-2-(dimethylamino)but-2-enamide;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 155072145 |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (Z)-2-(dimethylamino)but-2-enamide;2-hydroxybutanedioic acid |
| SMILES | C/C=C(/C(N)=O)N(C)C.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C6H12N2O.C4H6O5/c1-4-5(6(7)9)8(2)3;5-2(4(8)9)1-3(6)7/h4H,1-3H3,(H2,7,9);2,5H,1H2,(H,6,7)(H,8,9)/b5-4-; |
| InChIKey | FBYCHWWQJUJYRL-MKWAYWHRSA-N |
| XLogP | -1.16 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|