C18H18N2 — CID 155072945
2-methylidene-6-[(E)-2-phenylethenyl]-1,3,4,5-tetrahydro-1,5-benzodiazepine (PubChem CID 155072945) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-methylidene-6-[(E)-2-phenylethenyl]-1,3,4,5-tetrahydro-1,5-benzodiazepine.
| Compound Name | 2-methylidene-6-[(E)-2-phenylethenyl]-1,3,4,5-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 155072945 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-methylidene-6-[(E)-2-phenylethenyl]-1,3,4,5-tetrahydro-1,5-benzodiazepine |
| SMILES | C=C1CCNc2c(/C=C/c3ccccc3)cccc2N1 |
| InChI | InChI=1S/C18H18N2/c1-14-12-13-19-18-16(8-5-9-17(18)20-14)11-10-15-6-3-2-4-7-15/h2-11,19-20H,1,12-13H2/b11-10+ |
| InChIKey | HNIQAMMBIYPOSK-ZHACJKMWSA-N |
| XLogP | 4.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|