C13H26O6 — CID 155083507
(3,4,5-trihydroxy-2-methoxyhexyl) 3,3-dimethylbutanoate (PubChem CID 155083507) has the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. Its IUPAC name is (3,4,5-trihydroxy-2-methoxyhexyl) 3,3-dimethylbutanoate.
| Compound Name | (3,4,5-trihydroxy-2-methoxyhexyl) 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 155083507 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (3,4,5-trihydroxy-2-methoxyhexyl) 3,3-dimethylbutanoate |
| SMILES | COC(COC(=O)CC(C)(C)C)C(O)C(O)C(C)O |
| InChI | InChI=1S/C13H26O6/c1-8(14)11(16)12(17)9(18-5)7-19-10(15)6-13(2,3)4/h8-9,11-12,14,16-17H,6-7H2,1-5H3 |
| InChIKey | POZJQSXBESETTH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |