C35H30F6N2O3 — CID 15509210
4-[4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-morpholin-4-ylbenzo[f]chromen-3-yl]phenyl]morpholine (PubChem CID 15509210) has the molecular formula C35H30F6N2O3 and a molecular weight of 640.62 g/mol. Its IUPAC name is 4-[4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-morpholin-4-ylbenzo[f]chromen-3-yl]phenyl]morpholine.
| Compound Name | 4-[4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-morpholin-4-ylbenzo[f]chromen-3-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 15509210 |
| Molecular Formula | C35H30F6N2O3 |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | 4-[4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-morpholin-4-ylbenzo[f]chromen-3-yl]phenyl]morpholine |
| SMILES | FC(F)(F)c1ccc(C2(c3ccc(N4CCOCC4)cc3)C=Cc3c(cc(N4CCOCC4)c4ccccc34)O2)cc1C(F)(F)F |
| InChI | InChI=1S/C35H30F6N2O3/c36-34(37,38)29-10-7-24(21-30(29)35(39,40)41)33(23-5-8-25(9-6-23)42-13-17-44-18-14-42)12-11-28-26-3-1-2-4-27(26)31(22-32(28)46-33)43-15-19-45-20-16-43/h1-12,21-22H,13-20H2 |
| InChIKey | HVBJNCLBCJVIJC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|