C16H20N4 — CID 155116906
4-N-cyclopentyl-2-(4-methylphenyl)pyrimidine-4,5-diamine (PubChem CID 155116906) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-N-cyclopentyl-2-(4-methylphenyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-cyclopentyl-2-(4-methylphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 155116906 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-N-cyclopentyl-2-(4-methylphenyl)pyrimidine-4,5-diamine |
| SMILES | Cc1ccc(-c2ncc(N)c(NC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C16H20N4/c1-11-6-8-12(9-7-11)15-18-10-14(17)16(20-15)19-13-4-2-3-5-13/h6-10,13H,2-5,17H2,1H3,(H,18,19,20) |
| InChIKey | SAWCZFGCJYISFT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |