C28H26F3N3O3 — CID 155155444
(1S,10R)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-5-oxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 155155444) has the molecular formula C28H26F3N3O3 and a molecular weight of 509.53 g/mol. Its IUPAC name is (1S,10R)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-5-oxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | (1S,10R)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-5-oxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 155155444 |
| Molecular Formula | C28H26F3N3O3 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (1S,10R)-N-[(2,4-difluorophenyl)methyl]-10-(fluoromethyl)-5-oxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)CN1C[C@@H]2CC=C[C@@H]1CF |
| InChI | InChI=1S/C28H26F3N3O3/c29-12-21-7-4-8-22-14-33(21)16-25-27(37-17-18-5-2-1-3-6-18)26(35)23(15-34(22)25)28(36)32-13-19-9-10-20(30)11-24(19)31/h1-7,9-11,15,21-22H,8,12-14,16-17H2,(H,32,36)/t21-,22+/m1/s1 |
| InChIKey | HJBAVSYNXISCOP-YADHBBJMSA-N |
| XLogP | 4.29 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|